C11H15ClN2O — CID 80680631
4-(chloromethyl)-2-(2-methyloxan-2-yl)pyrimidine (PubChem CID 80680631) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2-methyloxan-2-yl)pyrimidine.
| Compound Name | 4-(chloromethyl)-2-(2-methyloxan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 80680631 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-(chloromethyl)-2-(2-methyloxan-2-yl)pyrimidine |
| SMILES | CC1(c2nccc(CCl)n2)CCCCO1 |
| InChI | InChI=1S/C11H15ClN2O/c1-11(5-2-3-7-15-11)10-13-6-4-9(8-12)14-10/h4,6H,2-3,5,7-8H2,1H3 |
| InChIKey | CECDOBOEQCNPAJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|