C9H14N4O — CID 80681823
4-(2-methyloxan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 80681823) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 4-(2-methyloxan-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-methyloxan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80681823 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 4-(2-methyloxan-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CC1(c2ncnc(N)n2)CCCCO1 |
| InChI | InChI=1S/C9H14N4O/c1-9(4-2-3-5-14-9)7-11-6-12-8(10)13-7/h6H,2-5H2,1H3,(H2,10,11,12,13) |
| InChIKey | CVQIBXRFDYAUGV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |