C12H14ClN5O — CID 80681439
4-amino-2-chloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 80681439) has the molecular formula C12H14ClN5O and a molecular weight of 279.73 g/mol. Its IUPAC name is 4-amino-2-chloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 4-amino-2-chloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 80681439 |
| Molecular Formula | C12H14ClN5O |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-amino-2-chloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | Cn1cnc(CCNC(=O)c2ccc(N)cc2Cl)n1 |
| InChI | InChI=1S/C12H14ClN5O/c1-18-7-16-11(17-18)4-5-15-12(19)9-3-2-8(14)6-10(9)13/h2-3,6-7H,4-5,14H2,1H3,(H,15,19) |
| InChIKey | OBSWJYKCCDHVFZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|