C13H16ClN5O2 — CID 107196358
methyl 5-amino-3-chloro-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]benzoate (PubChem CID 107196358) has the molecular formula C13H16ClN5O2 and a molecular weight of 309.76 g/mol. Its IUPAC name is methyl 5-amino-3-chloro-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]benzoate.
| Compound Name | methyl 5-amino-3-chloro-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 107196358 |
| Molecular Formula | C13H16ClN5O2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 5-amino-3-chloro-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]benzoate |
| SMILES | COC(=O)c1cc(N)cc(Cl)c1NCCc1ncn(C)n1 |
| InChI | InChI=1S/C13H16ClN5O2/c1-19-7-17-11(18-19)3-4-16-12-9(13(20)21-2)5-8(15)6-10(12)14/h5-7,16H,3-4,15H2,1-2H3 |
| InChIKey | MZMTUYWIIXXOIN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|