C13H19ClN2O3 — CID 107195444
methyl 5-amino-3-chloro-2-(4-methoxybutylamino)benzoate (PubChem CID 107195444) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is methyl 5-amino-3-chloro-2-(4-methoxybutylamino)benzoate.
| Compound Name | methyl 5-amino-3-chloro-2-(4-methoxybutylamino)benzoate |
|---|---|
| PubChem CID | 107195444 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl 5-amino-3-chloro-2-(4-methoxybutylamino)benzoate |
| SMILES | COCCCCNc1c(Cl)cc(N)cc1C(=O)OC |
| InChI | InChI=1S/C13H19ClN2O3/c1-18-6-4-3-5-16-12-10(13(17)19-2)7-9(15)8-11(12)14/h7-8,16H,3-6,15H2,1-2H3 |
| InChIKey | VGWHFPKCLMPLDT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|