C14H18ClN3O3 — CID 107196734
methyl 5-amino-3-chloro-2-[2-(cyclopropanecarbonylamino)ethylamino]benzoate (PubChem CID 107196734) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is methyl 5-amino-3-chloro-2-[2-(cyclopropanecarbonylamino)ethylamino]benzoate.
| Compound Name | methyl 5-amino-3-chloro-2-[2-(cyclopropanecarbonylamino)ethylamino]benzoate |
|---|---|
| PubChem CID | 107196734 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | methyl 5-amino-3-chloro-2-[2-(cyclopropanecarbonylamino)ethylamino]benzoate |
| SMILES | COC(=O)c1cc(N)cc(Cl)c1NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C14H18ClN3O3/c1-21-14(20)10-6-9(16)7-11(15)12(10)17-4-5-18-13(19)8-2-3-8/h6-8,17H,2-5,16H2,1H3,(H,18,19) |
| InChIKey | QNCWMQHLPOWVBY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|