C12H20N6O3 — CID 80683846
4-(N'-hydroxycarbamimidoyl)-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]oxane-4-carboxamide (PubChem CID 80683846) has the molecular formula C12H20N6O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-(N'-hydroxycarbamimidoyl)-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]oxane-4-carboxamide.
| Compound Name | 4-(N'-hydroxycarbamimidoyl)-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 80683846 |
| Molecular Formula | C12H20N6O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 4-(N'-hydroxycarbamimidoyl)-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]oxane-4-carboxamide |
| SMILES | Cn1cnc(CCNC(=O)C2(C(N)=NO)CCOCC2)n1 |
| InChI | InChI=1S/C12H20N6O3/c1-18-8-15-9(16-18)2-5-14-11(19)12(10(13)17-20)3-6-21-7-4-12/h8,20H,2-7H2,1H3,(H2,13,17)(H,14,19) |
| InChIKey | IANFGUFQRYUVLD-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|