C11H16Cl2N2S — CID 80687396
N-butyl-4-chloro-5-(chloromethyl)-N-cyclopropyl-1,3-thiazol-2-amine (PubChem CID 80687396) has the molecular formula C11H16Cl2N2S and a molecular weight of 279.24 g/mol. Its IUPAC name is N-butyl-4-chloro-5-(chloromethyl)-N-cyclopropyl-1,3-thiazol-2-amine.
| Compound Name | N-butyl-4-chloro-5-(chloromethyl)-N-cyclopropyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 80687396 |
| Molecular Formula | C11H16Cl2N2S |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | N-butyl-4-chloro-5-(chloromethyl)-N-cyclopropyl-1,3-thiazol-2-amine |
| SMILES | CCCCN(c1nc(Cl)c(CCl)s1)C1CC1 |
| InChI | InChI=1S/C11H16Cl2N2S/c1-2-3-6-15(8-4-5-8)11-14-10(13)9(7-12)16-11/h8H,2-7H2,1H3 |
| InChIKey | UDRYODXRALTCAA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|