C13H20Cl2N2S — CID 80687320
4-chloro-5-(chloromethyl)-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine (PubChem CID 80687320) has the molecular formula C13H20Cl2N2S and a molecular weight of 307.29 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-5-(chloromethyl)-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 80687320 |
| Molecular Formula | C13H20Cl2N2S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine |
| SMILES | CN(c1nc(Cl)c(CCl)s1)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H20Cl2N2S/c1-13(2)6-4-9(5-7-13)17(3)12-16-11(15)10(8-14)18-12/h9H,4-8H2,1-3H3 |
| InChIKey | ZAMWEBFUQWQKSN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|