4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid

C7H9ClN2O2S — CID 80687541

IUPAC4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid
SMILESCCN(C)c1nc(Cl)c(C(=O)O)s1
InChIInChI=1S/C7H9ClN2O2S/c1-3-10(2)7-9-5(8)4(13-7)6(11)12/h3H2,1-2H3,(H,11,12)
InChIKeyFLPCWFJFFDDEMS-UHFFFAOYSA-N
MW220.68 g/mol
LogP1.95
Rot. Bonds3

About 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid

4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 80687541) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid
PubChem CID80687541
Molecular FormulaC7H9ClN2O2S
Molecular Weight220.68 g/mol
Exact Mass220.01
IUPAC Name4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid
SMILESCCN(C)c1nc(Cl)c(C(=O)O)s1
InChIInChI=1S/C7H9ClN2O2S/c1-3-10(2)7-9-5(8)4(13-7)6(11)12/h3H2,1-2H3,(H,11,12)
InChIKeyFLPCWFJFFDDEMS-UHFFFAOYSA-N
XLogP1.95
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.68
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid (CID 80687541) is 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid is CCN(C)c1nc(Cl)c(C(=O)O)s1.
What is the InChIKey of 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid?
The InChIKey is FLPCWFJFFDDEMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O2S/c1-3-10(2)7-9-5(8)4(13-7)6(11)12/h3H2,1-2H3,(H,11,12).
What are the key properties of 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid?
4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid has a molecular weight of 220.68 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 80687541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).