4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid

C7H9ClN2O2S — CID 130580815

IUPAC4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid
SMILESCCCNc1nc(Cl)c(C(=O)O)s1
InChIInChI=1S/C7H9ClN2O2S/c1-2-3-9-7-10-5(8)4(13-7)6(11)12/h2-3H2,1H3,(H,9,10)(H,11,12)
InChIKeyKCWOJDCEAXAGHG-UHFFFAOYSA-N
MW220.68 g/mol
LogP2.32
Rot. Bonds4

About 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid

4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 130580815) has the molecular formula C7H9ClN2O2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid
PubChem CID130580815
Molecular FormulaC7H9ClN2O2S
Molecular Weight220.68 g/mol
Exact Mass220.01
IUPAC Name4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid
SMILESCCCNc1nc(Cl)c(C(=O)O)s1
InChIInChI=1S/C7H9ClN2O2S/c1-2-3-9-7-10-5(8)4(13-7)6(11)12/h2-3H2,1H3,(H,9,10)(H,11,12)
InChIKeyKCWOJDCEAXAGHG-UHFFFAOYSA-N
XLogP2.32
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.68
LogP ≤ 52.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid (CID 130580815) is 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid is CCCNc1nc(Cl)c(C(=O)O)s1.
What is the InChIKey of 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid?
The InChIKey is KCWOJDCEAXAGHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O2S/c1-2-3-9-7-10-5(8)4(13-7)6(11)12/h2-3H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid?
4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid has a molecular weight of 220.68 g/mol, XLogP of 2.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(propylamino)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 130580815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).