C8H9ClN2O2S — CID 117258671
4-chloro-2-(cyclobutylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 117258671) has the molecular formula C8H9ClN2O2S and a molecular weight of 232.69 g/mol. Its IUPAC name is 4-chloro-2-(cyclobutylamino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-chloro-2-(cyclobutylamino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117258671 |
| Molecular Formula | C8H9ClN2O2S |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 4-chloro-2-(cyclobutylamino)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(NC2CCC2)nc1Cl |
| InChI | InChI=1S/C8H9ClN2O2S/c9-6-5(7(12)13)14-8(11-6)10-4-2-1-3-4/h4H,1-3H2,(H,10,11)(H,12,13) |
| InChIKey | JXDNNFDMLRYETQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |