C10H6Cl2N4S — CID 80688149
2-(benzotriazol-1-yl)-4-chloro-5-(chloromethyl)-1,3-thiazole (PubChem CID 80688149) has the molecular formula C10H6Cl2N4S and a molecular weight of 285.16 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-4-chloro-5-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-(benzotriazol-1-yl)-4-chloro-5-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 80688149 |
| Molecular Formula | C10H6Cl2N4S |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 2-(benzotriazol-1-yl)-4-chloro-5-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1sc(-n2nnc3ccccc32)nc1Cl |
| InChI | InChI=1S/C10H6Cl2N4S/c11-5-8-9(12)13-10(17-8)16-7-4-2-1-3-6(7)14-15-16/h1-4H,5H2 |
| InChIKey | GCTXOTUKMHHSRO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|