C13H13Cl3N2S — CID 80688239
4-chloro-5-(chloromethyl)-N-[1-(3-chlorophenyl)ethyl]-N-methyl-1,3-thiazol-2-amine (PubChem CID 80688239) has the molecular formula C13H13Cl3N2S and a molecular weight of 335.69 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-N-[1-(3-chlorophenyl)ethyl]-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-5-(chloromethyl)-N-[1-(3-chlorophenyl)ethyl]-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 80688239 |
| Molecular Formula | C13H13Cl3N2S |
| Molecular Weight | 335.69 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-N-[1-(3-chlorophenyl)ethyl]-N-methyl-1,3-thiazol-2-amine |
| SMILES | CC(c1cccc(Cl)c1)N(C)c1nc(Cl)c(CCl)s1 |
| InChI | InChI=1S/C13H13Cl3N2S/c1-8(9-4-3-5-10(15)6-9)18(2)13-17-12(16)11(7-14)19-13/h3-6,8H,7H2,1-2H3 |
| InChIKey | ZZNACRPEMUUXDI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|