C16H20Cl2N2S — CID 62978324
1-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[1-(3-chlorophenyl)ethyl]-N-methylpropan-1-amine (PubChem CID 62978324) has the molecular formula C16H20Cl2N2S and a molecular weight of 343.32 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[1-(3-chlorophenyl)ethyl]-N-methylpropan-1-amine.
| Compound Name | 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[1-(3-chlorophenyl)ethyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 62978324 |
| Molecular Formula | C16H20Cl2N2S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[1-(3-chlorophenyl)ethyl]-N-methylpropan-1-amine |
| SMILES | CCC(c1nc(CCl)cs1)N(C)C(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2S/c1-4-15(16-19-14(9-17)10-21-16)20(3)11(2)12-6-5-7-13(18)8-12/h5-8,10-11,15H,4,9H2,1-3H3 |
| InChIKey | ITUMSYXFFTVUBO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|