C18H17ClN2S — CID 10476634
2-[2-[(3-chlorophenyl)-phenylmethyl]-1,3-thiazol-4-yl]ethanamine (PubChem CID 10476634) has the molecular formula C18H17ClN2S and a molecular weight of 328.87 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)-phenylmethyl]-1,3-thiazol-4-yl]ethanamine.
| Compound Name | 2-[2-[(3-chlorophenyl)-phenylmethyl]-1,3-thiazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 10476634 |
| Molecular Formula | C18H17ClN2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)-phenylmethyl]-1,3-thiazol-4-yl]ethanamine |
| SMILES | NCCc1csc(C(c2ccccc2)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C18H17ClN2S/c19-15-8-4-7-14(11-15)17(13-5-2-1-3-6-13)18-21-16(9-10-20)12-22-18/h1-8,11-12,17H,9-10,20H2 |
| InChIKey | AROSLNPYCLWUAD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |