About 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine
1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine (PubChem CID 112501302) has the molecular formula C11H21N3S
and a molecular weight of 227.38 g/mol. Its IUPAC name is 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine |
| PubChem CID | 112501302 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)C(C)c1nc(CCN)cs1 |
| InChI | InChI=1S/C11H21N3S/c1-4-14(5-2)9(3)11-13-10(6-7-12)8-15-11/h8-9H,4-7,12H2,1-3H3 |
| InChIKey | ACKPWEMJYUZYET-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine?
The IUPAC name of 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine (CID 112501302) is 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine.
What is the SMILES notation for 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine?
The canonical SMILES for 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine is CCN(CC)C(C)c1nc(CCN)cs1.
What is the InChIKey of 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine?
The InChIKey is ACKPWEMJYUZYET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3S/c1-4-14(5-2)9(3)11-13-10(6-7-12)8-15-11/h8-9H,4-7,12H2,1-3H3.
What are the key properties of 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine?
1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine has a molecular weight of 227.38 g/mol, XLogP of 2.05, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-aminoethyl)-1,3-thiazol-2-yl]-N,N-diethylethanamine is sourced from PubChem (CID 112501302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).