C14H23ClN2OS — CID 55227594
1-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(oxan-4-ylmethyl)propan-1-amine (PubChem CID 55227594) has the molecular formula C14H23ClN2OS and a molecular weight of 302.87 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(oxan-4-ylmethyl)propan-1-amine.
| Compound Name | 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(oxan-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 55227594 |
| Molecular Formula | C14H23ClN2OS |
| Molecular Weight | 302.87 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-methyl-N-(oxan-4-ylmethyl)propan-1-amine |
| SMILES | CCC(c1nc(CCl)cs1)N(C)CC1CCOCC1 |
| InChI | InChI=1S/C14H23ClN2OS/c1-3-13(14-16-12(8-15)10-19-14)17(2)9-11-4-6-18-7-5-11/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | ARTWJOQOLNJEQW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|