C10H15N5O — CID 80689704
N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-2-(1-methylpyrazol-4-yl)ethanamine (PubChem CID 80689704) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-2-(1-methylpyrazol-4-yl)ethanamine.
| Compound Name | N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-2-(1-methylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 80689704 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | N-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-2-(1-methylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nonc1CNCCc1cnn(C)c1 |
| InChI | InChI=1S/C10H15N5O/c1-8-10(14-16-13-8)6-11-4-3-9-5-12-15(2)7-9/h5,7,11H,3-4,6H2,1-2H3 |
| InChIKey | ZKHRNESMZPABQL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|