C14H17N3O3 — CID 80691509
2-amino-5-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 80691509) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-amino-5-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-amino-5-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 80691509 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-amino-5-[3-(2-methyloxan-2-yl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CC1(c2noc(-c3ccc(N)c(O)c3)n2)CCCCO1 |
| InChI | InChI=1S/C14H17N3O3/c1-14(6-2-3-7-19-14)13-16-12(20-17-13)9-4-5-10(15)11(18)8-9/h4-5,8,18H,2-3,6-7,15H2,1H3 |
| InChIKey | KONDPFDNEMFASZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|