C10H12FNO — CID 80694200
N-(2-fluoroethyl)-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 80694200) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | N-(2-fluoroethyl)-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 80694200 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(2-fluoroethyl)-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | FCCNC1COc2ccccc21 |
| InChI | InChI=1S/C10H12FNO/c11-5-6-12-9-7-13-10-4-2-1-3-8(9)10/h1-4,9,12H,5-7H2 |
| InChIKey | MHMNKSCEARPGPH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |