C13H17NO — CID 114472320
N-(3-methylbut-3-enyl)-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 114472320) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is N-(3-methylbut-3-enyl)-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | N-(3-methylbut-3-enyl)-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 114472320 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-(3-methylbut-3-enyl)-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | C=C(C)CCNC1COc2ccccc21 |
| InChI | InChI=1S/C13H17NO/c1-10(2)7-8-14-12-9-15-13-6-4-3-5-11(12)13/h3-6,12,14H,1,7-9H2,2H3 |
| InChIKey | LEVPXFDNBUIREZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|