C13H17N3O — CID 110050354
1-(2,3-dihydro-1-benzofuran-3-yl)-2-(2-methylprop-2-enyl)guanidine (PubChem CID 110050354) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-3-yl)-2-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-3-yl)-2-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 110050354 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-3-yl)-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\N)NC1COc2ccccc21 |
| InChI | InChI=1S/C13H17N3O/c1-9(2)7-15-13(14)16-11-8-17-12-6-4-3-5-10(11)12/h3-6,11H,1,7-8H2,2H3,(H3,14,15,16) |
| InChIKey | HXTQCUOHDBOZRJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|