C11H8BrClN4O2S2 — CID 80694565
3-[(5-bromopyrazin-2-yl)sulfamoyl]-4-chlorobenzenecarbothioamide (PubChem CID 80694565) has the molecular formula C11H8BrClN4O2S2 and a molecular weight of 407.70 g/mol. Its IUPAC name is 3-[(5-bromopyrazin-2-yl)sulfamoyl]-4-chlorobenzenecarbothioamide.
| Compound Name | 3-[(5-bromopyrazin-2-yl)sulfamoyl]-4-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 80694565 |
| Molecular Formula | C11H8BrClN4O2S2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 405.90 |
| IUPAC Name | 3-[(5-bromopyrazin-2-yl)sulfamoyl]-4-chlorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)c(S(=O)(=O)Nc2cnc(Br)cn2)c1 |
| InChI | InChI=1S/C11H8BrClN4O2S2/c12-9-4-16-10(5-15-9)17-21(18,19)8-3-6(11(14)20)1-2-7(8)13/h1-5H,(H2,14,20)(H,16,17) |
| InChIKey | JYSOZBZNMUZKJH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|