C10H18FNO2 — CID 80694789
1-(2-fluoroethyl)-3-propylpyrrolidine-3-carboxylic acid (PubChem CID 80694789) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-propylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-fluoroethyl)-3-propylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 80694789 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(2-fluoroethyl)-3-propylpyrrolidine-3-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCN(CCF)C1 |
| InChI | InChI=1S/C10H18FNO2/c1-2-3-10(9(13)14)4-6-12(8-10)7-5-11/h2-8H2,1H3,(H,13,14) |
| InChIKey | AQDMQTTZLFERCH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |