C13H27FN2 — CID 80696303
2,5,5-triethyl-1-(2-fluoroethyl)-2-methylpiperazine (PubChem CID 80696303) has the molecular formula C13H27FN2 and a molecular weight of 230.37 g/mol. Its IUPAC name is 2,5,5-triethyl-1-(2-fluoroethyl)-2-methylpiperazine.
| Compound Name | 2,5,5-triethyl-1-(2-fluoroethyl)-2-methylpiperazine |
|---|---|
| PubChem CID | 80696303 |
| Molecular Formula | C13H27FN2 |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 2,5,5-triethyl-1-(2-fluoroethyl)-2-methylpiperazine |
| SMILES | CCC1(CC)CN(CCF)C(C)(CC)CN1 |
| InChI | InChI=1S/C13H27FN2/c1-5-12(4)10-15-13(6-2,7-3)11-16(12)9-8-14/h15H,5-11H2,1-4H3 |
| InChIKey | XBEWMXQRZOUWAJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |