About 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine
5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine (PubChem CID 80697002) has the molecular formula C15H23FN2
and a molecular weight of 250.36 g/mol. Its IUPAC name is 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine |
| PubChem CID | 80697002 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNC(Cc2ccccc2)CN1CCF |
| InChI | InChI=1S/C15H23FN2/c1-15(2)12-17-14(11-18(15)9-8-16)10-13-6-4-3-5-7-13/h3-7,14,17H,8-12H2,1-2H3 |
| InChIKey | MNSULSVKLVTCIR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine?
The IUPAC name of 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine (CID 80697002) is 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine.
What is the SMILES notation for 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine?
The canonical SMILES for 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine is CC1(C)CNC(Cc2ccccc2)CN1CCF.
What is the InChIKey of 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine?
The InChIKey is MNSULSVKLVTCIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23FN2/c1-15(2)12-17-14(11-18(15)9-8-16)10-13-6-4-3-5-7-13/h3-7,14,17H,8-12H2,1-2H3.
What are the key properties of 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine?
5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine has a molecular weight of 250.36 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-1-(2-fluoroethyl)-2,2-dimethylpiperazine is sourced from PubChem (CID 80697002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).