C16H14BrNO3 — CID 80698460
5-bromo-2-[(3,4-dimethoxyphenyl)methoxy]benzonitrile (PubChem CID 80698460) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is 5-bromo-2-[(3,4-dimethoxyphenyl)methoxy]benzonitrile.
| Compound Name | 5-bromo-2-[(3,4-dimethoxyphenyl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 80698460 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 5-bromo-2-[(3,4-dimethoxyphenyl)methoxy]benzonitrile |
| SMILES | COc1ccc(COc2ccc(Br)cc2C#N)cc1OC |
| InChI | InChI=1S/C16H14BrNO3/c1-19-15-5-3-11(7-16(15)20-2)10-21-14-6-4-13(17)8-12(14)9-18/h3-8H,10H2,1-2H3 |
| InChIKey | UOMUNINAGAGNNN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |