C12H11N3O — CID 80702895
1-(1-benzofuran-3-ylmethyl)imidazol-2-amine (PubChem CID 80702895) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 1-(1-benzofuran-3-ylmethyl)imidazol-2-amine.
| Compound Name | 1-(1-benzofuran-3-ylmethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 80702895 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-(1-benzofuran-3-ylmethyl)imidazol-2-amine |
| SMILES | Nc1nccn1Cc1coc2ccccc12 |
| InChI | InChI=1S/C12H11N3O/c13-12-14-5-6-15(12)7-9-8-16-11-4-2-1-3-10(9)11/h1-6,8H,7H2,(H2,13,14) |
| InChIKey | KSAANWGHKBBRGC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |