C10H14N2O4S — CID 80707419
3-hydroxy-N-methyl-N-(2-methylsulfonylethyl)pyridine-4-carboxamide (PubChem CID 80707419) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-hydroxy-N-methyl-N-(2-methylsulfonylethyl)pyridine-4-carboxamide.
| Compound Name | 3-hydroxy-N-methyl-N-(2-methylsulfonylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 80707419 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-hydroxy-N-methyl-N-(2-methylsulfonylethyl)pyridine-4-carboxamide |
| SMILES | CN(CCS(C)(=O)=O)C(=O)c1ccncc1O |
| InChI | InChI=1S/C10H14N2O4S/c1-12(5-6-17(2,15)16)10(14)8-3-4-11-7-9(8)13/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | NLBDGGYKVIFSON-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |