C16H30N2O3 — CID 80710850
tert-butyl (2R)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]pyrrolidine-2-carboxylate (PubChem CID 80710850) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is tert-butyl (2R)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 80710850 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl (2R)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)C(C)NC(=O)CN1CCC[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N2O3/c1-11(2)12(3)17-14(19)10-18-9-7-8-13(18)15(20)21-16(4,5)6/h11-13H,7-10H2,1-6H3,(H,17,19)/t12?,13-/m1/s1 |
| InChIKey | WVRGNKFQXKMSSZ-ZGTCLIOFSA-N |
| XLogP | 1.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |