C14H13F4NO2 — CID 80711997
2-fluoro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-5-(trifluoromethyl)benzamide (PubChem CID 80711997) has the molecular formula C14H13F4NO2 and a molecular weight of 303.25 g/mol. Its IUPAC name is 2-fluoro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 80711997 |
| Molecular Formula | C14H13F4NO2 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-fluoro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CC2CCC1O2)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C14H13F4NO2/c15-10-3-1-7(14(16,17)18)5-9(10)13(20)19-11-6-8-2-4-12(11)21-8/h1,3,5,8,11-12H,2,4,6H2,(H,19,20) |
| InChIKey | ZKUSQOFFVPIEOI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |