C10H16N2O3 — CID 80713003
1-ethyl-3-(oxolan-3-ylamino)pyrrolidine-2,5-dione (PubChem CID 80713003) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-ethyl-3-(oxolan-3-ylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-ethyl-3-(oxolan-3-ylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 80713003 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-ethyl-3-(oxolan-3-ylamino)pyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)CC(NC2CCOC2)C1=O |
| InChI | InChI=1S/C10H16N2O3/c1-2-12-9(13)5-8(10(12)14)11-7-3-4-15-6-7/h7-8,11H,2-6H2,1H3 |
| InChIKey | XSLUZOWCEZOIJZ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|