C14H18N2O2 — CID 80716475
1-methyl-4-(oxolan-3-ylamino)-3,4-dihydroquinolin-2-one (PubChem CID 80716475) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-methyl-4-(oxolan-3-ylamino)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-methyl-4-(oxolan-3-ylamino)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 80716475 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-methyl-4-(oxolan-3-ylamino)-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CC(NC2CCOC2)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O2/c1-16-13-5-3-2-4-11(13)12(8-14(16)17)15-10-6-7-18-9-10/h2-5,10,12,15H,6-9H2,1H3 |
| InChIKey | DHMBQOKSSZFJNQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |