C13H18N2O3S — CID 80713947
N-(oxolan-3-yl)-1,2,3,4-tetrahydroisoquinoline-5-sulfonamide (PubChem CID 80713947) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-(oxolan-3-yl)-1,2,3,4-tetrahydroisoquinoline-5-sulfonamide.
| Compound Name | N-(oxolan-3-yl)-1,2,3,4-tetrahydroisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 80713947 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(oxolan-3-yl)-1,2,3,4-tetrahydroisoquinoline-5-sulfonamide |
| SMILES | O=S(=O)(NC1CCOC1)c1cccc2c1CCNC2 |
| InChI | InChI=1S/C13H18N2O3S/c16-19(17,15-11-5-7-18-9-11)13-3-1-2-10-8-14-6-4-12(10)13/h1-3,11,14-15H,4-9H2 |
| InChIKey | JFZJNLTZJAGFGT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |