C12H18N2O5 — CID 80719933
(2S)-4-hydroxy-1-(7-oxabicyclo[2.2.1]heptan-2-ylcarbamoyl)pyrrolidine-2-carboxylic acid (PubChem CID 80719933) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is (2S)-4-hydroxy-1-(7-oxabicyclo[2.2.1]heptan-2-ylcarbamoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-hydroxy-1-(7-oxabicyclo[2.2.1]heptan-2-ylcarbamoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 80719933 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2S)-4-hydroxy-1-(7-oxabicyclo[2.2.1]heptan-2-ylcarbamoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(O)CN1C(=O)NC1CC2CCC1O2 |
| InChI | InChI=1S/C12H18N2O5/c15-6-3-9(11(16)17)14(5-6)12(18)13-8-4-7-1-2-10(8)19-7/h6-10,15H,1-5H2,(H,13,18)(H,16,17)/t6?,7?,8?,9-,10?/m0/s1 |
| InChIKey | BVVUURJNDNNXBL-SPWRCNBUSA-N |
| XLogP | -0.46 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |