C15H14N2O2S2 — CID 80721923
N-[2-(4-aminophenoxy)ethyl]thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 80721923) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[2-(4-aminophenoxy)ethyl]thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-[2-(4-aminophenoxy)ethyl]thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 80721923 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-[2-(4-aminophenoxy)ethyl]thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | Nc1ccc(OCCNC(=O)c2cc3sccc3s2)cc1 |
| InChI | InChI=1S/C15H14N2O2S2/c16-10-1-3-11(4-2-10)19-7-6-17-15(18)14-9-13-12(21-14)5-8-20-13/h1-5,8-9H,6-7,16H2,(H,17,18) |
| InChIKey | SIBOWZABQCHINQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|