C12H14ClNO2S2 — CID 114163177
N-(3-chloro-4-methoxybutyl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 114163177) has the molecular formula C12H14ClNO2S2 and a molecular weight of 303.84 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(3-chloro-4-methoxybutyl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 114163177 |
| Molecular Formula | C12H14ClNO2S2 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | COCC(Cl)CCNC(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C12H14ClNO2S2/c1-16-7-8(13)2-4-14-12(15)11-6-10-9(18-11)3-5-17-10/h3,5-6,8H,2,4,7H2,1H3,(H,14,15) |
| InChIKey | HGLGJARMKCSZTN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|