C15H9ClN2S2 — CID 80722271
4-chloro-5-methyl-2-thieno[3,2-b]thiophen-5-ylquinazoline (PubChem CID 80722271) has the molecular formula C15H9ClN2S2 and a molecular weight of 316.84 g/mol. Its IUPAC name is 4-chloro-5-methyl-2-thieno[3,2-b]thiophen-5-ylquinazoline.
| Compound Name | 4-chloro-5-methyl-2-thieno[3,2-b]thiophen-5-ylquinazoline |
|---|---|
| PubChem CID | 80722271 |
| Molecular Formula | C15H9ClN2S2 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 4-chloro-5-methyl-2-thieno[3,2-b]thiophen-5-ylquinazoline |
| SMILES | Cc1cccc2nc(-c3cc4sccc4s3)nc(Cl)c12 |
| InChI | InChI=1S/C15H9ClN2S2/c1-8-3-2-4-9-13(8)14(16)18-15(17-9)12-7-11-10(20-12)5-6-19-11/h2-7H,1H3 |
| InChIKey | ZHPYJAHVMYADLE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |