C13H16N4O3 — CID 80724118
N-(1H-imidazol-5-ylmethyl)-3-nitro-5-propan-2-yloxyaniline (PubChem CID 80724118) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-3-nitro-5-propan-2-yloxyaniline.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-3-nitro-5-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 80724118 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-3-nitro-5-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(NCc2cnc[nH]2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N4O3/c1-9(2)20-13-4-10(3-12(5-13)17(18)19)15-7-11-6-14-8-16-11/h3-6,8-9,15H,7H2,1-2H3,(H,14,16) |
| InChIKey | WXNDLQYGASZAMP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|