C13H16Cl3NS — CID 80726014
N-[(2-methylthiolan-2-yl)methyl]-1-(2,3,6-trichlorophenyl)methanamine (PubChem CID 80726014) has the molecular formula C13H16Cl3NS and a molecular weight of 324.70 g/mol. Its IUPAC name is N-[(2-methylthiolan-2-yl)methyl]-1-(2,3,6-trichlorophenyl)methanamine.
| Compound Name | N-[(2-methylthiolan-2-yl)methyl]-1-(2,3,6-trichlorophenyl)methanamine |
|---|---|
| PubChem CID | 80726014 |
| Molecular Formula | C13H16Cl3NS |
| Molecular Weight | 324.70 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-[(2-methylthiolan-2-yl)methyl]-1-(2,3,6-trichlorophenyl)methanamine |
| SMILES | CC1(CNCc2c(Cl)ccc(Cl)c2Cl)CCCS1 |
| InChI | InChI=1S/C13H16Cl3NS/c1-13(5-2-6-18-13)8-17-7-9-10(14)3-4-11(15)12(9)16/h3-4,17H,2,5-8H2,1H3 |
| InChIKey | YWMYXOFIJNMBRM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|