C14H18Cl3NS — CID 80726555
N-[(2-methylthiolan-2-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine (PubChem CID 80726555) has the molecular formula C14H18Cl3NS and a molecular weight of 338.73 g/mol. Its IUPAC name is N-[(2-methylthiolan-2-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine.
| Compound Name | N-[(2-methylthiolan-2-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 80726555 |
| Molecular Formula | C14H18Cl3NS |
| Molecular Weight | 338.73 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | N-[(2-methylthiolan-2-yl)methyl]-1-(2,3,4-trichlorophenyl)ethanamine |
| SMILES | CC(NCC1(C)CCCS1)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H18Cl3NS/c1-9(18-8-14(2)6-3-7-19-14)10-4-5-11(15)13(17)12(10)16/h4-5,9,18H,3,6-8H2,1-2H3 |
| InChIKey | GHWHGCRORQDIEY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.73 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|