C17H32N2S — CID 80727929
N-[[4-[(dipropylamino)methyl]-5-methylthiophen-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 80727929) has the molecular formula C17H32N2S and a molecular weight of 296.52 g/mol. Its IUPAC name is N-[[4-[(dipropylamino)methyl]-5-methylthiophen-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[4-[(dipropylamino)methyl]-5-methylthiophen-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 80727929 |
| Molecular Formula | C17H32N2S |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N-[[4-[(dipropylamino)methyl]-5-methylthiophen-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCCN(CCC)Cc1cc(CNC(C)(C)C)sc1C |
| InChI | InChI=1S/C17H32N2S/c1-7-9-19(10-8-2)13-15-11-16(20-14(15)3)12-18-17(4,5)6/h11,18H,7-10,12-13H2,1-6H3 |
| InChIKey | VQHCYJAZFUPMJM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |