C16H29NO2S — CID 80733906
2-methyl-N-[[5-methyl-4-(2-propoxyethoxymethyl)thiophen-2-yl]methyl]propan-2-amine (PubChem CID 80733906) has the molecular formula C16H29NO2S and a molecular weight of 299.48 g/mol. Its IUPAC name is 2-methyl-N-[[5-methyl-4-(2-propoxyethoxymethyl)thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[5-methyl-4-(2-propoxyethoxymethyl)thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 80733906 |
| Molecular Formula | C16H29NO2S |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-methyl-N-[[5-methyl-4-(2-propoxyethoxymethyl)thiophen-2-yl]methyl]propan-2-amine |
| SMILES | CCCOCCOCc1cc(CNC(C)(C)C)sc1C |
| InChI | InChI=1S/C16H29NO2S/c1-6-7-18-8-9-19-12-14-10-15(20-13(14)2)11-17-16(3,4)5/h10,17H,6-9,11-12H2,1-5H3 |
| InChIKey | NOWUZBAMZVWOCX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|