C9H12O3S — CID 80730360
4-(ethoxymethyl)-5-methylthiophene-2-carboxylic acid (PubChem CID 80730360) has the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. Its IUPAC name is 4-(ethoxymethyl)-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-(ethoxymethyl)-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 80730360 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 4-(ethoxymethyl)-5-methylthiophene-2-carboxylic acid |
| SMILES | CCOCc1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C9H12O3S/c1-3-12-5-7-4-8(9(10)11)13-6(7)2/h4H,3,5H2,1-2H3,(H,10,11) |
| InChIKey | MNLPKHHUUUPFEW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |