C9H15N3O3 — CID 80732924
2-(2-hydroxyethyl)-1,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,4-dione (PubChem CID 80732924) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-1,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,4-dione.
| Compound Name | 2-(2-hydroxyethyl)-1,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,4-dione |
|---|---|
| PubChem CID | 80732924 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-(2-hydroxyethyl)-1,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,4-dione |
| SMILES | O=C1C(=O)N2CCNCC2CN1CCO |
| InChI | InChI=1S/C9H15N3O3/c13-4-3-11-6-7-5-10-1-2-12(7)9(15)8(11)14/h7,10,13H,1-6H2 |
| InChIKey | BFHDEHQXUFOASH-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|