C10H10ClN3O4S3 — CID 80735745
5-chloro-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 80735745) has the molecular formula C10H10ClN3O4S3 and a molecular weight of 367.86 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80735745 |
| Molecular Formula | C10H10ClN3O4S3 |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 5-chloro-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1nc(CN(C)S(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)cs1 |
| InChI | InChI=1S/C10H10ClN3O4S3/c1-6-12-7(5-19-6)4-13(2)21(17,18)9-3-8(14(15)16)10(11)20-9/h3,5H,4H2,1-2H3 |
| InChIKey | ZGWYISWSJZVJON-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|