C12H14N2OS — CID 80736004
5-ethoxy-3-N-thiophen-3-ylbenzene-1,3-diamine (PubChem CID 80736004) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 5-ethoxy-3-N-thiophen-3-ylbenzene-1,3-diamine.
| Compound Name | 5-ethoxy-3-N-thiophen-3-ylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 80736004 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-ethoxy-3-N-thiophen-3-ylbenzene-1,3-diamine |
| SMILES | CCOc1cc(N)cc(Nc2ccsc2)c1 |
| InChI | InChI=1S/C12H14N2OS/c1-2-15-12-6-9(13)5-11(7-12)14-10-3-4-16-8-10/h3-8,14H,2,13H2,1H3 |
| InChIKey | VGIABLBNCPPWQO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|