C14H14ClFN2O — CID 107363634
3-N-(3-chloro-5-fluorophenyl)-5-ethoxybenzene-1,3-diamine (PubChem CID 107363634) has the molecular formula C14H14ClFN2O and a molecular weight of 280.73 g/mol. Its IUPAC name is 3-N-(3-chloro-5-fluorophenyl)-5-ethoxybenzene-1,3-diamine.
| Compound Name | 3-N-(3-chloro-5-fluorophenyl)-5-ethoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 107363634 |
| Molecular Formula | C14H14ClFN2O |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3-N-(3-chloro-5-fluorophenyl)-5-ethoxybenzene-1,3-diamine |
| SMILES | CCOc1cc(N)cc(Nc2cc(F)cc(Cl)c2)c1 |
| InChI | InChI=1S/C14H14ClFN2O/c1-2-19-14-7-11(17)6-13(8-14)18-12-4-9(15)3-10(16)5-12/h3-8,18H,2,17H2,1H3 |
| InChIKey | FIDKXRNDBWHONV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|