C11H8F2N8 — CID 80736972
2-N-(3,4-difluorophenyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 80736972) has the molecular formula C11H8F2N8 and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-N-(3,4-difluorophenyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3,4-difluorophenyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80736972 |
| Molecular Formula | C11H8F2N8 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-N-(3,4-difluorophenyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccc(F)c(F)c2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C11H8F2N8/c12-7-2-1-6(3-8(7)13)17-10-18-9(14)19-11(20-10)21-5-15-4-16-21/h1-5H,(H3,14,17,18,19,20) |
| InChIKey | MNMUZJOMJZHDMK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |